C11H13ClN2O3S — CID 107651248
2-chloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonamide (PubChem CID 107651248) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 2-chloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 107651248 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-chloro-N-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonamide |
| SMILES | O=C1CCc2cc(NS(=O)(=O)CCCl)ccc2N1 |
| InChI | InChI=1S/C11H13ClN2O3S/c12-5-6-18(16,17)14-9-2-3-10-8(7-9)1-4-11(15)13-10/h2-3,7,14H,1,4-6H2,(H,13,15) |
| InChIKey | XDESBXMPCOBMIX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|