C6H11ClN4O2S — CID 107652046
2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanesulfonamide (PubChem CID 107652046) has the molecular formula C6H11ClN4O2S and a molecular weight of 238.70 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanesulfonamide.
| Compound Name | 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652046 |
| Molecular Formula | C6H11ClN4O2S |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-chloro-N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)ethanesulfonamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)CCCl |
| InChI | InChI=1S/C6H11ClN4O2S/c1-11(14(12,13)3-2-7)4-6-8-5-9-10-6/h5H,2-4H2,1H3,(H,8,9,10) |
| InChIKey | AYIPWMQWUSSICA-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|