C22H36N2O3Si2 — CID 10765207
(4S)-3-[(2R,3S)-1-[bis(trimethylsilyl)methyl]-2-ethyl-2-methyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10765207) has the molecular formula C22H36N2O3Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is (4S)-3-[(2R,3S)-1-[bis(trimethylsilyl)methyl]-2-ethyl-2-methyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3S)-1-[bis(trimethylsilyl)methyl]-2-ethyl-2-methyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10765207 |
| Molecular Formula | C22H36N2O3Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | (4S)-3-[(2R,3S)-1-[bis(trimethylsilyl)methyl]-2-ethyl-2-methyl-4-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@]1(C)[C@H](N2C(=O)OC[C@@H]2c2ccccc2)C(=O)N1C([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C22H36N2O3Si2/c1-9-22(2)18(19(25)24(22)21(28(3,4)5)29(6,7)8)23-17(15-27-20(23)26)16-13-11-10-12-14-16/h10-14,17-18,21H,9,15H2,1-8H3/t17-,18-,22-/m1/s1 |
| InChIKey | AVMQZSDGYBWECU-JBYIUTFZSA-N |
| XLogP | 4.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|