C10H19ClN2O3S — CID 107652152
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloroethanesulfonamide (PubChem CID 107652152) has the molecular formula C10H19ClN2O3S and a molecular weight of 282.79 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloroethanesulfonamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloroethanesulfonamide |
|---|---|
| PubChem CID | 107652152 |
| Molecular Formula | C10H19ClN2O3S |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloroethanesulfonamide |
| SMILES | O=S(=O)(CCCl)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C10H19ClN2O3S/c11-3-5-17(14,15)12-6-10-7-13-4-1-2-9(13)8-16-10/h9-10,12H,1-8H2 |
| InChIKey | TUFQGYCBHSKTIL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|