C8H14ClNO — CID 138550760
(3R)-3-(chloromethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine (PubChem CID 138550760) has the molecular formula C8H14ClNO and a molecular weight of 175.66 g/mol. Its IUPAC name is (3R)-3-(chloromethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine.
| Compound Name | (3R)-3-(chloromethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 138550760 |
| Molecular Formula | C8H14ClNO |
| Molecular Weight | 175.66 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (3R)-3-(chloromethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazine |
| SMILES | ClC[C@H]1CN2CCCC2CO1 |
| InChI | InChI=1S/C8H14ClNO/c9-4-8-5-10-3-1-2-7(10)6-11-8/h7-8H,1-6H2/t7?,8-/m0/s1 |
| InChIKey | UCDANKIMQBZXSO-MQWKRIRWSA-N |
| XLogP | 1.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.66 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|