C16H29N3O — CID 79071464
9-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-amine (PubChem CID 79071464) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 9-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-amine.
| Compound Name | 9-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-amine |
|---|---|
| PubChem CID | 79071464 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 9-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-9-azabicyclo[3.3.1]nonan-3-amine |
| SMILES | NC1CC2CCCC(C1)N2CC1CN2CCCC2CO1 |
| InChI | InChI=1S/C16H29N3O/c17-12-7-13-3-1-4-14(8-12)19(13)10-16-9-18-6-2-5-15(18)11-20-16/h12-16H,1-11,17H2 |
| InChIKey | OZUJUSXPAQILMH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |