C12H17ClN4O3S — CID 79080061
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloropyrimidine-5-sulfonamide (PubChem CID 79080061) has the molecular formula C12H17ClN4O3S and a molecular weight of 332.81 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloropyrimidine-5-sulfonamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloropyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 79080061 |
| Molecular Formula | C12H17ClN4O3S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2-chloropyrimidine-5-sulfonamide |
| SMILES | O=S(=O)(NCC1CN2CCCC2CO1)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C12H17ClN4O3S/c13-12-14-5-11(6-15-12)21(18,19)16-4-10-7-17-3-1-2-9(17)8-20-10/h5-6,9-10,16H,1-4,7-8H2 |
| InChIKey | CHLKAANMLRIWIS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |