C14H17Cl2N3O2 — CID 114918645
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,5-dichloropyridine-4-carboxamide (PubChem CID 114918645) has the molecular formula C14H17Cl2N3O2 and a molecular weight of 330.22 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,5-dichloropyridine-4-carboxamide.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,5-dichloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 114918645 |
| Molecular Formula | C14H17Cl2N3O2 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-2,5-dichloropyridine-4-carboxamide |
| SMILES | O=C(NCC1CN2CCCC2CO1)c1cc(Cl)ncc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O2/c15-12-6-17-13(16)4-11(12)14(20)18-5-10-7-19-3-1-2-9(19)8-21-10/h4,6,9-10H,1-3,5,7-8H2,(H,18,20) |
| InChIKey | MVUYAMZGYWSSHQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|