C9H15ClN2O3S — CID 107652299
2-(2-chloroethylsulfonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 107652299) has the molecular formula C9H15ClN2O3S and a molecular weight of 266.75 g/mol. Its IUPAC name is 2-(2-chloroethylsulfonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-(2-chloroethylsulfonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 107652299 |
| Molecular Formula | C9H15ClN2O3S |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-(2-chloroethylsulfonyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(S(=O)(=O)CCCl)CCN12 |
| InChI | InChI=1S/C9H15ClN2O3S/c10-3-6-16(14,15)11-4-5-12-8(7-11)1-2-9(12)13/h8H,1-7H2 |
| InChIKey | DQSFNIHTRJQLEA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|