C9H16ClNO3S — CID 107652550
1-(2-chloroethylsulfonyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine (PubChem CID 107652550) has the molecular formula C9H16ClNO3S and a molecular weight of 253.75 g/mol. Its IUPAC name is 1-(2-chloroethylsulfonyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-chloroethylsulfonyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 107652550 |
| Molecular Formula | C9H16ClNO3S |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1-(2-chloroethylsulfonyl)-4-(methoxymethyl)-3,6-dihydro-2H-pyridine |
| SMILES | COCC1=CCN(S(=O)(=O)CCCl)CC1 |
| InChI | InChI=1S/C9H16ClNO3S/c1-14-8-9-2-5-11(6-3-9)15(12,13)7-4-10/h2H,3-8H2,1H3 |
| InChIKey | YPHJXPPCOOBAHJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|