C14H19NO4S — CID 114413877
[2-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]methanol (PubChem CID 114413877) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is [2-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]methanol.
| Compound Name | [2-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]methanol |
|---|---|
| PubChem CID | 114413877 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [2-[[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]sulfonyl]phenyl]methanol |
| SMILES | COCC1=CCN(S(=O)(=O)c2ccccc2CO)CC1 |
| InChI | InChI=1S/C14H19NO4S/c1-19-11-12-6-8-15(9-7-12)20(17,18)14-5-3-2-4-13(14)10-16/h2-6,16H,7-11H2,1H3 |
| InChIKey | FQOYHXJYXNGLOR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|