C13H15BrClNO3S — CID 114393249
1-(4-bromo-2-chlorophenyl)sulfonyl-4-(methoxymethyl)-3,6-dihydro-2H-pyridine (PubChem CID 114393249) has the molecular formula C13H15BrClNO3S and a molecular weight of 380.69 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)sulfonyl-4-(methoxymethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-4-(methoxymethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114393249 |
| Molecular Formula | C13H15BrClNO3S |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 378.96 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)sulfonyl-4-(methoxymethyl)-3,6-dihydro-2H-pyridine |
| SMILES | COCC1=CCN(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C13H15BrClNO3S/c1-19-9-10-4-6-16(7-5-10)20(17,18)13-3-2-11(14)8-12(13)15/h2-4,8H,5-7,9H2,1H3 |
| InChIKey | IMOXFSIHPIKDSM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|