C14H23N3O — CID 107654554
1-(4-amino-2-ethylbutyl)-3-benzylurea (PubChem CID 107654554) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 1-(4-amino-2-ethylbutyl)-3-benzylurea.
| Compound Name | 1-(4-amino-2-ethylbutyl)-3-benzylurea |
|---|---|
| PubChem CID | 107654554 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 1-(4-amino-2-ethylbutyl)-3-benzylurea |
| SMILES | CCC(CCN)CNC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H23N3O/c1-2-12(8-9-15)10-16-14(18)17-11-13-6-4-3-5-7-13/h3-7,12H,2,8-11,15H2,1H3,(H2,16,17,18) |
| InChIKey | XZXDROMNKNRJHI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |