C16H24N2O4 — CID 122020996
4-[[2-(2-hydroxyethyl)pentylcarbamoylamino]methyl]benzoic acid (PubChem CID 122020996) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-[[2-(2-hydroxyethyl)pentylcarbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[2-(2-hydroxyethyl)pentylcarbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122020996 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 4-[[2-(2-hydroxyethyl)pentylcarbamoylamino]methyl]benzoic acid |
| SMILES | CCCC(CCO)CNC(=O)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C16H24N2O4/c1-2-3-12(8-9-19)10-17-16(22)18-11-13-4-6-14(7-5-13)15(20)21/h4-7,12,19H,2-3,8-11H2,1H3,(H,20,21)(H2,17,18,22) |
| InChIKey | NLVHBMMUOZKTSX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |