C28H35N3O2 — CID 10765759
benzyl N-[[(6aR,9S,10aR)-2-tert-butyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate (PubChem CID 10765759) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is benzyl N-[[(6aR,9S,10aR)-2-tert-butyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(6aR,9S,10aR)-2-tert-butyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate |
|---|---|
| PubChem CID | 10765759 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | benzyl N-[[(6aR,9S,10aR)-2-tert-butyl-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate |
| SMILES | CN1C[C@H](CNC(=O)OCc2ccccc2)C[C@@H]2c3cc(C(C)(C)C)cc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C28H35N3O2/c1-28(2,3)21-12-23-22-10-19(14-30-27(32)33-17-18-8-6-5-7-9-18)16-31(4)25(22)11-20-15-29-24(13-21)26(20)23/h5-9,12-13,15,19,22,25,29H,10-11,14,16-17H2,1-4H3,(H,30,32)/t19-,22+,25+/m0/s1 |
| InChIKey | JIEYWGGNJSSGDF-UWUFEASWSA-N |
| XLogP | 5.35 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |