C9H9BrCl2N2O2 — CID 107661601
2-(4-bromo-2,5-dichlorophenoxy)propanehydrazide (PubChem CID 107661601) has the molecular formula C9H9BrCl2N2O2 and a molecular weight of 327.99 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)propanehydrazide.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 107661601 |
| Molecular Formula | C9H9BrCl2N2O2 |
| Molecular Weight | 327.99 g/mol |
| Exact Mass | 325.92 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)propanehydrazide |
| SMILES | CC(Oc1cc(Cl)c(Br)cc1Cl)C(=O)NN |
| InChI | InChI=1S/C9H9BrCl2N2O2/c1-4(9(15)14-13)16-8-3-6(11)5(10)2-7(8)12/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | TZGLQMJAPNWLOF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.99 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|