C12H13BrCl2O3 — CID 114282482
2-(4-bromo-2,5-dichlorophenoxy)-4-methylpentanoic acid (PubChem CID 114282482) has the molecular formula C12H13BrCl2O3 and a molecular weight of 356.04 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpentanoic acid.
| Compound Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 114282482 |
| Molecular Formula | C12H13BrCl2O3 |
| Molecular Weight | 356.04 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 2-(4-bromo-2,5-dichlorophenoxy)-4-methylpentanoic acid |
| SMILES | CC(C)CC(Oc1cc(Cl)c(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C12H13BrCl2O3/c1-6(2)3-11(12(16)17)18-10-5-8(14)7(13)4-9(10)15/h4-6,11H,3H2,1-2H3,(H,16,17) |
| InChIKey | XOHLFAWWNKLPMU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|