C12H9Cl3O6 — CID 151299792
2-[2-(2,4,5-trichlorophenoxy)propanoyl]propanedioic acid (PubChem CID 151299792) has the molecular formula C12H9Cl3O6 and a molecular weight of 355.56 g/mol. Its IUPAC name is 2-[2-(2,4,5-trichlorophenoxy)propanoyl]propanedioic acid.
| Compound Name | 2-[2-(2,4,5-trichlorophenoxy)propanoyl]propanedioic acid |
|---|---|
| PubChem CID | 151299792 |
| Molecular Formula | C12H9Cl3O6 |
| Molecular Weight | 355.56 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-[2-(2,4,5-trichlorophenoxy)propanoyl]propanedioic acid |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H9Cl3O6/c1-4(10(16)9(11(17)18)12(19)20)21-8-3-6(14)5(13)2-7(8)15/h2-4,9H,1H3,(H,17,18)(H,19,20) |
| InChIKey | OCEIWBOCPZOVJW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.56 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|