C11H14Cl3NO4 — CID 23841
2-hydroxyethylazanium;2-(2,4,5-trichlorophenoxy)propanoate (PubChem CID 23841) has the molecular formula C11H14Cl3NO4 and a molecular weight of 330.60 g/mol. Its IUPAC name is 2-hydroxyethylazanium;2-(2,4,5-trichlorophenoxy)propanoate.
| Compound Name | 2-hydroxyethylazanium;2-(2,4,5-trichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 23841 |
| Molecular Formula | C11H14Cl3NO4 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-hydroxyethylazanium;2-(2,4,5-trichlorophenoxy)propanoate |
| SMILES | CC(Oc1cc(Cl)c(Cl)cc1Cl)C(=O)[O-].[NH3+]CCO |
| InChI | InChI=1S/C9H7Cl3O3.C2H7NO/c1-4(9(13)14)15-8-3-6(11)5(10)2-7(8)12;3-1-2-4/h2-4H,1H3,(H,13,14);4H,1-3H2 |
| InChIKey | MKBCHJJOUBFJIP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|