C22H33FO3SeSi — CID 10766789
methyl 2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexyl]-2-phenylselanylacetate (PubChem CID 10766789) has the molecular formula C22H33FO3SeSi and a molecular weight of 471.55 g/mol. Its IUPAC name is methyl 2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexyl]-2-phenylselanylacetate.
| Compound Name | methyl 2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexyl]-2-phenylselanylacetate |
|---|---|
| PubChem CID | 10766789 |
| Molecular Formula | C22H33FO3SeSi |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | methyl 2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-fluoro-2-methylidenecyclohexyl]-2-phenylselanylacetate |
| SMILES | C=C1C(C([Se]c2ccccc2)C(=O)OC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C22H33FO3SeSi/c1-15-18(20(21(24)25-5)27-17-11-9-8-10-12-17)13-16(14-19(15)23)26-28(6,7)22(2,3)4/h8-12,16,18-20H,1,13-14H2,2-7H3/t16-,18?,19+,20?/m1/s1 |
| InChIKey | ZSTSWTFYPKHCBM-OTBHMBEGSA-N |
| XLogP | 4.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|