C30H44O3Si2 — CID 10885702
methyl 2-[(1R,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate (PubChem CID 10885702) has the molecular formula C30H44O3Si2 and a molecular weight of 508.85 g/mol. Its IUPAC name is methyl 2-[(1R,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 10885702 |
| Molecular Formula | C30H44O3Si2 |
| Molecular Weight | 508.85 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | methyl 2-[(1R,2R,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[(E)-3-trimethylsilylprop-1-enyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1/C=C/C[Si](C)(C)C |
| InChI | InChI=1S/C30H44O3Si2/c1-30(2,3)35(25-15-10-8-11-16-25,26-17-12-9-13-18-26)33-28-21-20-24(23-29(31)32-4)27(28)19-14-22-34(5,6)7/h8-19,24,27-28H,20-23H2,1-7H3/b19-14+/t24-,27+,28+/m1/s1 |
| InChIKey | BUAYRXGUQFZVLH-GSMKNQJLSA-N |
| XLogP | 6.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.85 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|