C17H19ClN4O7S2 — CID 10767400
N-(2-sulfamoyl-1,3-benzothiazol-6-yl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate (PubChem CID 10767400) has the molecular formula C17H19ClN4O7S2 and a molecular weight of 490.95 g/mol. Its IUPAC name is N-(2-sulfamoyl-1,3-benzothiazol-6-yl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate.
| Compound Name | N-(2-sulfamoyl-1,3-benzothiazol-6-yl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10767400 |
| Molecular Formula | C17H19ClN4O7S2 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-(2-sulfamoyl-1,3-benzothiazol-6-yl)-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
| SMILES | Cc1cc(C)[n+](CC(=O)Nc2ccc3nc(S(N)(=O)=O)sc3c2)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H18N4O3S2.ClHO4/c1-10-6-11(2)21(12(3)7-10)9-16(22)19-13-4-5-14-15(8-13)25-17(20-14)26(18,23)24;2-1(3,4)5/h4-8H,9H2,1-3H3,(H2-,18,19,22,23,24);(H,2,3,4,5) |
| InChIKey | NNUPFNNJFWVSBU-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 198.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|