C12H16FN3O2 — CID 107674411
[2-(aminomethyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone (PubChem CID 107674411) has the molecular formula C12H16FN3O2 and a molecular weight of 253.28 g/mol. Its IUPAC name is [2-(aminomethyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone.
| Compound Name | [2-(aminomethyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107674411 |
| Molecular Formula | C12H16FN3O2 |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [2-(aminomethyl)piperazin-1-yl]-(2-fluoro-4-hydroxyphenyl)methanone |
| SMILES | NCC1CNCCN1C(=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C12H16FN3O2/c13-11-5-9(17)1-2-10(11)12(18)16-4-3-15-7-8(16)6-14/h1-2,5,8,15,17H,3-4,6-7,14H2 |
| InChIKey | ILJOAXGWTYIQGZ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |