C11H15FN4O — CID 104637984
[2-(aminomethyl)piperazin-1-yl]-(5-fluoro-2-pyridinyl)methanone (PubChem CID 104637984) has the molecular formula C11H15FN4O and a molecular weight of 238.27 g/mol. Its IUPAC name is [2-(aminomethyl)piperazin-1-yl]-(5-fluoro-2-pyridinyl)methanone.
| Compound Name | [2-(aminomethyl)piperazin-1-yl]-(5-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 104637984 |
| Molecular Formula | C11H15FN4O |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | [2-(aminomethyl)piperazin-1-yl]-(5-fluoro-2-pyridinyl)methanone |
| SMILES | NCC1CNCCN1C(=O)c1ccc(F)cn1 |
| InChI | InChI=1S/C11H15FN4O/c12-8-1-2-10(15-6-8)11(17)16-4-3-14-7-9(16)5-13/h1-2,6,9,14H,3-5,7,13H2 |
| InChIKey | OTBMGMJSQPDDOS-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |