C17H15F4N3O — CID 120735841
[2-(3-fluorophenyl)piperazin-1-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 120735841) has the molecular formula C17H15F4N3O and a molecular weight of 353.32 g/mol. Its IUPAC name is [2-(3-fluorophenyl)piperazin-1-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | [2-(3-fluorophenyl)piperazin-1-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 120735841 |
| Molecular Formula | C17H15F4N3O |
| Molecular Weight | 353.32 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [2-(3-fluorophenyl)piperazin-1-yl]-[5-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cn1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C17H15F4N3O/c18-13-3-1-2-11(8-13)15-10-22-6-7-24(15)16(25)14-5-4-12(9-23-14)17(19,20)21/h1-5,8-9,15,22H,6-7,10H2 |
| InChIKey | OZIYIFDVFSTEHG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |