C27H30N2OS3 — CID 10767527
3-[1-(benzenesulfinyl)butyl]-N,N'-diphenylpentanedithioamide (PubChem CID 10767527) has the molecular formula C27H30N2OS3 and a molecular weight of 494.75 g/mol. Its IUPAC name is 3-[1-(benzenesulfinyl)butyl]-N,N'-diphenylpentanedithioamide.
| Compound Name | 3-[1-(benzenesulfinyl)butyl]-N,N'-diphenylpentanedithioamide |
|---|---|
| PubChem CID | 10767527 |
| Molecular Formula | C27H30N2OS3 |
| Molecular Weight | 494.75 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-[1-(benzenesulfinyl)butyl]-N,N'-diphenylpentanedithioamide |
| SMILES | CCCC(C(CC(=S)Nc1ccccc1)CC(=S)Nc1ccccc1)S(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N2OS3/c1-2-12-25(33(30)24-17-10-5-11-18-24)21(19-26(31)28-22-13-6-3-7-14-22)20-27(32)29-23-15-8-4-9-16-23/h3-11,13-18,21,25H,2,12,19-20H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | NSZGRCHQHYGONP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.75 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|