C28H26N4O5 — CID 10767632
diethyl 2-[[[5-(4-methoxyphenyl)-7-phenylpyrido[2,3-d]pyrimidin-4-yl]amino]methylidene]propanedioate (PubChem CID 10767632) has the molecular formula C28H26N4O5 and a molecular weight of 498.54 g/mol. Its IUPAC name is diethyl 2-[[[5-(4-methoxyphenyl)-7-phenylpyrido[2,3-d]pyrimidin-4-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[5-(4-methoxyphenyl)-7-phenylpyrido[2,3-d]pyrimidin-4-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 10767632 |
| Molecular Formula | C28H26N4O5 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | diethyl 2-[[[5-(4-methoxyphenyl)-7-phenylpyrido[2,3-d]pyrimidin-4-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1ncnc2nc(-c3ccccc3)cc(-c3ccc(OC)cc3)c12)C(=O)OCC |
| InChI | InChI=1S/C28H26N4O5/c1-4-36-27(33)22(28(34)37-5-2)16-29-25-24-21(18-11-13-20(35-3)14-12-18)15-23(19-9-7-6-8-10-19)32-26(24)31-17-30-25/h6-17H,4-5H2,1-3H3,(H,29,30,31,32) |
| InChIKey | QUNQCLYUPRSOKY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|