C18H20N2O5S — CID 12603882
diethyl 2-[[[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]amino]methylidene]propanedioate (PubChem CID 12603882) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is diethyl 2-[[[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 12603882 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | diethyl 2-[[[3-(4-methoxyphenyl)-1,2-thiazol-5-yl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1cc(-c2ccc(OC)cc2)ns1)C(=O)OCC |
| InChI | InChI=1S/C18H20N2O5S/c1-4-24-17(21)14(18(22)25-5-2)11-19-16-10-15(20-26-16)12-6-8-13(23-3)9-7-12/h6-11,19H,4-5H2,1-3H3 |
| InChIKey | VNJXZBIVYAUQQJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|