C27H26N6O4 — CID 10767633
N-[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-9-anilinoacridine-4-carboxamide (PubChem CID 10767633) has the molecular formula C27H26N6O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is N-[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-9-anilinoacridine-4-carboxamide.
| Compound Name | N-[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-9-anilinoacridine-4-carboxamide |
|---|---|
| PubChem CID | 10767633 |
| Molecular Formula | C27H26N6O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[2-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-2-oxoethyl]-9-anilinoacridine-4-carboxamide |
| SMILES | C[C@H](NC(=O)CNC(=O)c1cccc2c(Nc3ccccc3)c3ccccc3nc12)C(=O)NCC(N)=O |
| InChI | InChI=1S/C27H26N6O4/c1-16(26(36)29-14-22(28)34)31-23(35)15-30-27(37)20-12-7-11-19-24(32-17-8-3-2-4-9-17)18-10-5-6-13-21(18)33-25(19)20/h2-13,16H,14-15H2,1H3,(H2,28,34)(H,29,36)(H,30,37)(H,31,35)(H,32,33)/t16-/m0/s1 |
| InChIKey | YRFHBDGCRFRNOQ-INIZCTEOSA-N |
| XLogP | 1.97 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|