C27H54O4Si2 — CID 10767660
(5R,8R,9S)-8,9-bis[tri(propan-2-yl)silyloxy]-6-oxaspiro[4.5]decan-4-one (PubChem CID 10767660) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is (5R,8R,9S)-8,9-bis[tri(propan-2-yl)silyloxy]-6-oxaspiro[4.5]decan-4-one.
| Compound Name | (5R,8R,9S)-8,9-bis[tri(propan-2-yl)silyloxy]-6-oxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 10767660 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | (5R,8R,9S)-8,9-bis[tri(propan-2-yl)silyloxy]-6-oxaspiro[4.5]decan-4-one |
| SMILES | CC(C)[Si](O[C@H]1C[C@@]2(CCCC2=O)OC[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H54O4Si2/c1-18(2)32(19(3)4,20(5)6)30-24-16-27(15-13-14-26(27)28)29-17-25(24)31-33(21(7)8,22(9)10)23(11)12/h18-25H,13-17H2,1-12H3/t24-,25+,27+/m0/s1 |
| InChIKey | GXDXWRLDBWNLRK-ZWEKWIFMSA-N |
| XLogP | 8.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|