C14H19NOS — CID 107682497
1-(thiolan-2-ylmethylamino)-2,3-dihydro-1H-inden-5-ol (PubChem CID 107682497) has the molecular formula C14H19NOS and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(thiolan-2-ylmethylamino)-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-(thiolan-2-ylmethylamino)-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107682497 |
| Molecular Formula | C14H19NOS |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-(thiolan-2-ylmethylamino)-2,3-dihydro-1H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CCC2NCC1CCCS1 |
| InChI | InChI=1S/C14H19NOS/c16-11-4-5-13-10(8-11)3-6-14(13)15-9-12-2-1-7-17-12/h4-5,8,12,14-16H,1-3,6-7,9H2 |
| InChIKey | QOAPYTYQDVVMFW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |