About 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol
5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684733) has the molecular formula C16H14F2O2
and a molecular weight of 276.28 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 107684733 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(OCc3ccc(F)cc3F)ccc21 |
| InChI | InChI=1S/C16H14F2O2/c17-12-3-1-11(15(18)8-12)9-20-13-4-5-14-10(7-13)2-6-16(14)19/h1,3-5,7-8,16,19H,2,6,9H2 |
| InChIKey | VGJRGOLHBHZPPH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol (CID 107684733) is 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol is OC1CCc2cc(OCc3ccc(F)cc3F)ccc21.
What is the InChIKey of 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol?
The InChIKey is VGJRGOLHBHZPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F2O2/c17-12-3-1-11(15(18)8-12)9-20-13-4-5-14-10(7-13)2-6-16(14)19/h1,3-5,7-8,16,19H,2,6,9H2.
What are the key properties of 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol?
5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol has a molecular weight of 276.28 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 107684733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).