C16H14F2O2 — CID 107684733
5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684733) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684733 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-[(2,4-difluorophenyl)methoxy]-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(OCc3ccc(F)cc3F)ccc21 |
| InChI | InChI=1S/C16H14F2O2/c17-12-3-1-11(15(18)8-12)9-20-13-4-5-14-10(7-13)2-6-16(14)19/h1,3-5,7-8,16,19H,2,6,9H2 |
| InChIKey | VGJRGOLHBHZPPH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |