C13H20FNO3 — CID 107694482
2-[(2,2-diethoxyethylamino)methyl]-4-fluorophenol (PubChem CID 107694482) has the molecular formula C13H20FNO3 and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-[(2,2-diethoxyethylamino)methyl]-4-fluorophenol.
| Compound Name | 2-[(2,2-diethoxyethylamino)methyl]-4-fluorophenol |
|---|---|
| PubChem CID | 107694482 |
| Molecular Formula | C13H20FNO3 |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[(2,2-diethoxyethylamino)methyl]-4-fluorophenol |
| SMILES | CCOC(CNCc1cc(F)ccc1O)OCC |
| InChI | InChI=1S/C13H20FNO3/c1-3-17-13(18-4-2)9-15-8-10-7-11(14)5-6-12(10)16/h5-7,13,15-16H,3-4,8-9H2,1-2H3 |
| InChIKey | VCHFLZOGDGRBTO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|