C17H20FNO2 — CID 107695916
3-[[4-fluoro-2-(propylaminomethyl)phenoxy]methyl]phenol (PubChem CID 107695916) has the molecular formula C17H20FNO2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 3-[[4-fluoro-2-(propylaminomethyl)phenoxy]methyl]phenol.
| Compound Name | 3-[[4-fluoro-2-(propylaminomethyl)phenoxy]methyl]phenol |
|---|---|
| PubChem CID | 107695916 |
| Molecular Formula | C17H20FNO2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-[[4-fluoro-2-(propylaminomethyl)phenoxy]methyl]phenol |
| SMILES | CCCNCc1cc(F)ccc1OCc1cccc(O)c1 |
| InChI | InChI=1S/C17H20FNO2/c1-2-8-19-11-14-10-15(18)6-7-17(14)21-12-13-4-3-5-16(20)9-13/h3-7,9-10,19-20H,2,8,11-12H2,1H3 |
| InChIKey | MXNMHHOHVJYUEE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|