C18H22ClNO — CID 63485880
N-[[2-[(3-chlorophenyl)methoxy]-5-methylphenyl]methyl]propan-1-amine (PubChem CID 63485880) has the molecular formula C18H22ClNO and a molecular weight of 303.83 g/mol. Its IUPAC name is N-[[2-[(3-chlorophenyl)methoxy]-5-methylphenyl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(3-chlorophenyl)methoxy]-5-methylphenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63485880 |
| Molecular Formula | C18H22ClNO |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-[[2-[(3-chlorophenyl)methoxy]-5-methylphenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(C)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H22ClNO/c1-3-9-20-12-16-10-14(2)7-8-18(16)21-13-15-5-4-6-17(19)11-15/h4-8,10-11,20H,3,9,12-13H2,1-2H3 |
| InChIKey | HXGBBOGACKBMQA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|