C30H41NO2SeSi2 — CID 10769600
4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethyl-2-phenylselanylpentanamide (PubChem CID 10769600) has the molecular formula C30H41NO2SeSi2 and a molecular weight of 582.80 g/mol. Its IUPAC name is 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethyl-2-phenylselanylpentanamide.
| Compound Name | 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethyl-2-phenylselanylpentanamide |
|---|---|
| PubChem CID | 10769600 |
| Molecular Formula | C30H41NO2SeSi2 |
| Molecular Weight | 582.80 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethyl-2-phenylselanylpentanamide |
| SMILES | CCN(CC)C(=O)C(CC(C)O[Si](c1ccccc1)(c1ccccc1)[Si](C)(C)C)[Se]c1ccccc1 |
| InChI | InChI=1S/C30H41NO2SeSi2/c1-7-31(8-2)30(32)29(34-26-18-12-9-13-19-26)24-25(3)33-36(35(4,5)6,27-20-14-10-15-21-27)28-22-16-11-17-23-28/h9-23,25,29H,7-8,24H2,1-6H3 |
| InChIKey | WFQZPRHIJBRUMG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.80 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|