C24H37NO2Si2 — CID 10574511
4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethylpentanamide (PubChem CID 10574511) has the molecular formula C24H37NO2Si2 and a molecular weight of 427.74 g/mol. Its IUPAC name is 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethylpentanamide.
| Compound Name | 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethylpentanamide |
|---|---|
| PubChem CID | 10574511 |
| Molecular Formula | C24H37NO2Si2 |
| Molecular Weight | 427.74 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 4-[diphenyl(trimethylsilyl)silyl]oxy-N,N-diethylpentanamide |
| SMILES | CCN(CC)C(=O)CCC(C)O[Si](c1ccccc1)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C24H37NO2Si2/c1-7-25(8-2)24(26)20-19-21(3)27-29(28(4,5)6,22-15-11-9-12-16-22)23-17-13-10-14-18-23/h9-18,21H,7-8,19-20H2,1-6H3 |
| InChIKey | PRPACNXJUCIRKJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|