C30H37NO2Si — CID 134887002
[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 134887002) has the molecular formula C30H37NO2Si and a molecular weight of 471.72 g/mol. Its IUPAC name is [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 134887002 |
| Molecular Formula | C30H37NO2Si |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC(C)(C)[Si](OCCC1(C(=O)N2CC=CCC2)C=CCC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37NO2Si/c1-29(2,3)34(26-16-8-4-9-17-26,27-18-10-5-11-19-27)33-25-22-30(20-12-6-13-21-30)28(32)31-23-14-7-15-24-31/h4-5,7-14,16-21H,6,15,22-25H2,1-3H3 |
| InChIKey | FRTUKJFUSCBOSY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|