C26H37NO2Si — CID 10550232
(Z)-6-[tert-butyl(diphenyl)silyl]oxy-N,N-diethylhex-5-enamide (PubChem CID 10550232) has the molecular formula C26H37NO2Si and a molecular weight of 423.67 g/mol. Its IUPAC name is (Z)-6-[tert-butyl(diphenyl)silyl]oxy-N,N-diethylhex-5-enamide.
| Compound Name | (Z)-6-[tert-butyl(diphenyl)silyl]oxy-N,N-diethylhex-5-enamide |
|---|---|
| PubChem CID | 10550232 |
| Molecular Formula | C26H37NO2Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (Z)-6-[tert-butyl(diphenyl)silyl]oxy-N,N-diethylhex-5-enamide |
| SMILES | CCN(CC)C(=O)CCC/C=C\O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H37NO2Si/c1-6-27(7-2)25(28)21-15-10-16-22-29-30(26(3,4)5,23-17-11-8-12-18-23)24-19-13-9-14-20-24/h8-9,11-14,16-20,22H,6-7,10,15,21H2,1-5H3/b22-16- |
| InChIKey | WYXDFELFBAIRBA-JWGURIENSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|