C23H33NO3Si — CID 11418148
3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylbutanamide (PubChem CID 11418148) has the molecular formula C23H33NO3Si and a molecular weight of 399.61 g/mol. Its IUPAC name is 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylbutanamide.
| Compound Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 11418148 |
| Molecular Formula | C23H33NO3Si |
| Molecular Weight | 399.61 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CC(CO)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H33NO3Si/c1-23(2,3)28(20-12-8-6-9-13-20,21-14-10-7-11-15-21)27-18-19(17-25)16-22(26)24(4)5/h6-15,19,25H,16-18H2,1-5H3 |
| InChIKey | CCHKLDZWGDUPSL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|