C35H53NO3Si — CID 11342024
(3S,4R,7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N,4,8,12-pentamethyltrideca-7,11-dienamide (PubChem CID 11342024) has the molecular formula C35H53NO3Si and a molecular weight of 563.90 g/mol. Its IUPAC name is (3S,4R,7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N,4,8,12-pentamethyltrideca-7,11-dienamide.
| Compound Name | (3S,4R,7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N,4,8,12-pentamethyltrideca-7,11-dienamide |
|---|---|
| PubChem CID | 11342024 |
| Molecular Formula | C35H53NO3Si |
| Molecular Weight | 563.90 g/mol |
| Exact Mass | 563.38 |
| IUPAC Name | (3S,4R,7E)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxy-N,N,4,8,12-pentamethyltrideca-7,11-dienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@@](C)(O)[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)N(C)C |
| InChI | InChI=1S/C35H53NO3Si/c1-28(2)18-16-19-29(3)20-17-25-35(7,38)30(26-33(37)36(8)9)27-39-40(34(4,5)6,31-21-12-10-13-22-31)32-23-14-11-15-24-32/h10-15,18,20-24,30,38H,16-17,19,25-27H2,1-9H3/b29-20+/t30-,35+/m0/s1 |
| InChIKey | HYCHFWZLQLWSBD-ICUSUQGPSA-N |
| XLogP | 6.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.90 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|