C26H33NO3Si — CID 178119956
1-[(3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)pyrrolidin-1-yl]but-2-yn-1-one (PubChem CID 178119956) has the molecular formula C26H33NO3Si and a molecular weight of 435.64 g/mol. Its IUPAC name is 1-[(3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)pyrrolidin-1-yl]but-2-yn-1-one.
| Compound Name | 1-[(3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)pyrrolidin-1-yl]but-2-yn-1-one |
|---|---|
| PubChem CID | 178119956 |
| Molecular Formula | C26H33NO3Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-[(3R,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(hydroxymethyl)pyrrolidin-1-yl]but-2-yn-1-one |
| SMILES | CC#CC(=O)N1C[C@@H](CO)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C26H33NO3Si/c1-5-12-25(29)27-17-21(19-28)22(18-27)20-30-31(26(2,3)4,23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-11,13-16,21-22,28H,17-20H2,1-4H3/t21-,22+/m0/s1 |
| InChIKey | IMEKIGBVWMZSKX-FCHUYYIVSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|