C23H33NO4Si — CID 11133483
(2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,2-dimethylbutanamide (PubChem CID 11133483) has the molecular formula C23H33NO4Si and a molecular weight of 415.61 g/mol. Its IUPAC name is (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,2-dimethylbutanamide.
| Compound Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 11133483 |
| Molecular Formula | C23H33NO4Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,2-dimethylbutanamide |
| SMILES | CON(C)C(=O)[C@@H](C)[C@@H](CO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H33NO4Si/c1-18(22(26)24(5)27-6)21(17-25)28-29(23(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21,25H,17H2,1-6H3/t18-,21+/m0/s1 |
| InChIKey | XFYZQIZPCDWSAU-GHTZIAJQSA-N |
| XLogP | 2.58 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|