C24H35NO4Si — CID 11133763
(2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide (PubChem CID 11133763) has the molecular formula C24H35NO4Si and a molecular weight of 429.63 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide.
| Compound Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 11133763 |
| Molecular Formula | C24H35NO4Si |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2R)-2-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-N-methoxy-N,3,3-trimethylbutanamide |
| SMILES | CON(C)C(=O)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)(C)CO |
| InChI | InChI=1S/C24H35NO4Si/c1-23(2,3)30(19-14-10-8-11-15-19,20-16-12-9-13-17-20)29-21(24(4,5)18-26)22(27)25(6)28-7/h8-17,21,26H,18H2,1-7H3/t21-/m0/s1 |
| InChIKey | UKMRPYBYMOHFSF-NRFANRHFSA-N |
| XLogP | 2.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|