C37H47NO2Si2 — CID 11342364
1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(Z)-3-[dimethyl(phenyl)silyl]prop-2-enyl]-N-methylcyclohexa-2,5-diene-1-carboxamide (PubChem CID 11342364) has the molecular formula C37H47NO2Si2 and a molecular weight of 593.96 g/mol. Its IUPAC name is 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(Z)-3-[dimethyl(phenyl)silyl]prop-2-enyl]-N-methylcyclohexa-2,5-diene-1-carboxamide.
| Compound Name | 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(Z)-3-[dimethyl(phenyl)silyl]prop-2-enyl]-N-methylcyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 11342364 |
| Molecular Formula | C37H47NO2Si2 |
| Molecular Weight | 593.96 g/mol |
| Exact Mass | 593.31 |
| IUPAC Name | 1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-N-[(Z)-3-[dimethyl(phenyl)silyl]prop-2-enyl]-N-methylcyclohexa-2,5-diene-1-carboxamide |
| SMILES | CN(C/C=C\[Si](C)(C)c1ccccc1)C(=O)C1(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CCC=C1 |
| InChI | InChI=1S/C37H47NO2Si2/c1-36(2,3)42(33-22-13-8-14-23-33,34-24-15-9-16-25-34)40-30-28-37(26-17-10-18-27-37)35(39)38(4)29-19-31-41(5,6)32-20-11-7-12-21-32/h7-9,11-27,31H,10,28-30H2,1-6H3/b31-19- |
| InChIKey | HHUZLVFLHQFCTF-DXJNIWACSA-N |
| XLogP | 6.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.96 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|