C29H35NO2Si — CID 101263527
[1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(2,5-dihydropyrrol-1-yl)methanone (PubChem CID 101263527) has the molecular formula C29H35NO2Si and a molecular weight of 457.69 g/mol. Its IUPAC name is [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(2,5-dihydropyrrol-1-yl)methanone.
| Compound Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(2,5-dihydropyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 101263527 |
| Molecular Formula | C29H35NO2Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | [1-[2-[tert-butyl(diphenyl)silyl]oxyethyl]cyclohexa-2,5-dien-1-yl]-(2,5-dihydropyrrol-1-yl)methanone |
| SMILES | CC(C)(C)[Si](OCCC1(C(=O)N2CC=CC2)C=CCC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H35NO2Si/c1-28(2,3)33(25-15-7-4-8-16-25,26-17-9-5-10-18-26)32-24-21-29(19-11-6-12-20-29)27(31)30-22-13-14-23-30/h4-5,7-20H,6,21-24H2,1-3H3 |
| InChIKey | YNBHPRRWJLOJRL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|