C30H47NO2Si — CID 11167577
(2R)-N-[(3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexyl]-N,2-dimethylbutanamide (PubChem CID 11167577) has the molecular formula C30H47NO2Si and a molecular weight of 481.80 g/mol. Its IUPAC name is (2R)-N-[(3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexyl]-N,2-dimethylbutanamide.
| Compound Name | (2R)-N-[(3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexyl]-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 11167577 |
| Molecular Formula | C30H47NO2Si |
| Molecular Weight | 481.80 g/mol |
| Exact Mass | 481.34 |
| IUPAC Name | (2R)-N-[(3S,5S)-6-[tert-butyl(diphenyl)silyl]oxy-3,5-dimethylhexyl]-N,2-dimethylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N(C)CC[C@@H](C)C[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H47NO2Si/c1-9-26(4)29(32)31(8)21-20-24(2)22-25(3)23-33-34(30(5,6)7,27-16-12-10-13-17-27)28-18-14-11-15-19-28/h10-19,24-26H,9,20-23H2,1-8H3/t24-,25+,26-/m1/s1 |
| InChIKey | NWWBCWOMGNBPEH-UODIDJSMSA-N |
| XLogP | 6.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.80 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|