C38H61NO2Si — CID 123488240
N-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-N-propan-2-ylheptanamide (PubChem CID 123488240) has the molecular formula C38H61NO2Si and a molecular weight of 592.00 g/mol. Its IUPAC name is N-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-N-propan-2-ylheptanamide.
| Compound Name | N-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 123488240 |
| Molecular Formula | C38H61NO2Si |
| Molecular Weight | 592.00 g/mol |
| Exact Mass | 591.45 |
| IUPAC Name | N-[12-[tert-butyl(diphenyl)silyl]oxydodec-5-enyl]-N-propan-2-ylheptanamide |
| SMILES | CCCCCCC(=O)N(CCCCC=CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C38H61NO2Si/c1-7-8-9-24-31-37(40)39(34(2)3)32-25-16-14-12-10-11-13-15-17-26-33-41-42(38(4,5)6,35-27-20-18-21-28-35)36-29-22-19-23-30-36/h10,12,18-23,27-30,34H,7-9,11,13-17,24-26,31-33H2,1-6H3 |
| InChIKey | APDXZFPFOVFAQH-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.00 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|