C47H84N2O4Si — CID 158110680
N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide;heptanoic acid;N-propan-2-ylhexan-1-amine (PubChem CID 158110680) has the molecular formula C47H84N2O4Si and a molecular weight of 769.28 g/mol. Its IUPAC name is N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide;heptanoic acid;N-propan-2-ylhexan-1-amine.
| Compound Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide;heptanoic acid;N-propan-2-ylhexan-1-amine |
|---|---|
| PubChem CID | 158110680 |
| Molecular Formula | C47H84N2O4Si |
| Molecular Weight | 769.28 g/mol |
| Exact Mass | 768.62 |
| IUPAC Name | N-[5-[tert-butyl(diphenyl)silyl]oxypentyl]-N-propan-2-ylheptanamide;heptanoic acid;N-propan-2-ylhexan-1-amine |
| SMILES | CCCCCCC(=O)N(CCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)C.CCCCCCC(=O)O.CCCCCCNC(C)C |
| InChI | InChI=1S/C31H49NO2Si.C9H21N.C7H14O2/c1-7-8-9-17-24-30(33)32(27(2)3)25-18-12-19-26-34-35(31(4,5)6,28-20-13-10-14-21-28)29-22-15-11-16-23-29;1-4-5-6-7-8-10-9(2)3;1-2-3-4-5-6-7(8)9/h10-11,13-16,20-23,27H,7-9,12,17-19,24-26H2,1-6H3;9-10H,4-8H2,1-3H3;2-6H2,1H3,(H,8,9) |
| InChIKey | FQJVEYVHGKEYQA-UHFFFAOYSA-N |
| XLogP | 11.55 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.28 |
| LogP ≤ 5 | 11.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|