C32H47NO4Si — CID 70027211
1-[(3S,4S)-5-acetamido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylhexyl]cyclopentane-1-carboxylic acid (PubChem CID 70027211) has the molecular formula C32H47NO4Si and a molecular weight of 537.82 g/mol. Its IUPAC name is 1-[(3S,4S)-5-acetamido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylhexyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(3S,4S)-5-acetamido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylhexyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 70027211 |
| Molecular Formula | C32H47NO4Si |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 1-[(3S,4S)-5-acetamido-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-methylhexyl]cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)NC(C)[C@@H](C)[C@H](CCC1(C(=O)O)CCCC1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H47NO4Si/c1-24(25(2)33-26(3)34)27(19-22-32(30(35)36)20-13-14-21-32)23-37-38(31(4,5)6,28-15-9-7-10-16-28)29-17-11-8-12-18-29/h7-12,15-18,24-25,27H,13-14,19-23H2,1-6H3,(H,33,34)(H,35,36)/t24-,25?,27-/m1/s1 |
| InChIKey | MHQGCQTVIOFKCW-PTYBVJFYSA-N |
| XLogP | 5.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|